C12H10N2 — CID 70598379
2-azatricyclo[7.4.0.03,5]trideca-1(13),2,5,7,9,11-hexaen-6-amine (PubChem CID 70598379) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-azatricyclo[7.4.0.03,5]trideca-1(13),2,5,7,9,11-hexaen-6-amine.
| Compound Name | 2-azatricyclo[7.4.0.03,5]trideca-1(13),2,5,7,9,11-hexaen-6-amine |
|---|---|
| PubChem CID | 70598379 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 2-azatricyclo[7.4.0.03,5]trideca-1(13),2,5,7,9,11-hexaen-6-amine |
| SMILES | NC1=C2C/C2=N/c2ccccc2C=C1 |
| InChI | InChI=1S/C12H10N2/c13-10-6-5-8-3-1-2-4-11(8)14-12-7-9(10)12/h1-6H,7,13H2/b6-5?,8-5?,10-6?,10-9?,14-11-,14-12- |
| InChIKey | KTHMZLQBOCENOL-FXIZXPQQSA-N |
| XLogP | 2.40 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |