C18H31Br2NO3 — CID 70600493
2,6-dibromo-4-octylphenol;2-(2-hydroxyethylamino)ethanol (PubChem CID 70600493) has the molecular formula C18H31Br2NO3 and a molecular weight of 469.26 g/mol. Its IUPAC name is 2,6-dibromo-4-octylphenol;2-(2-hydroxyethylamino)ethanol.
| Compound Name | 2,6-dibromo-4-octylphenol;2-(2-hydroxyethylamino)ethanol |
|---|---|
| PubChem CID | 70600493 |
| Molecular Formula | C18H31Br2NO3 |
| Molecular Weight | 469.26 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 2,6-dibromo-4-octylphenol;2-(2-hydroxyethylamino)ethanol |
| SMILES | CCCCCCCCc1cc(Br)c(O)c(Br)c1.OCCNCCO |
| InChI | InChI=1S/C14H20Br2O.C4H11NO2/c1-2-3-4-5-6-7-8-11-9-12(15)14(17)13(16)10-11;6-3-1-5-2-4-7/h9-10,17H,2-8H2,1H3;5-7H,1-4H2 |
| InChIKey | UOGRYVJROQPJQK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.26 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|