C15H25Br2NO3 — CID 70600575
2,6-dibromo-4-pentylphenol;2-(2-hydroxyethylamino)ethanol (PubChem CID 70600575) has the molecular formula C15H25Br2NO3 and a molecular weight of 427.18 g/mol. Its IUPAC name is 2,6-dibromo-4-pentylphenol;2-(2-hydroxyethylamino)ethanol.
| Compound Name | 2,6-dibromo-4-pentylphenol;2-(2-hydroxyethylamino)ethanol |
|---|---|
| PubChem CID | 70600575 |
| Molecular Formula | C15H25Br2NO3 |
| Molecular Weight | 427.18 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 2,6-dibromo-4-pentylphenol;2-(2-hydroxyethylamino)ethanol |
| SMILES | CCCCCc1cc(Br)c(O)c(Br)c1.OCCNCCO |
| InChI | InChI=1S/C11H14Br2O.C4H11NO2/c1-2-3-4-5-8-6-9(12)11(14)10(13)7-8;6-3-1-5-2-4-7/h6-7,14H,2-5H2,1H3;5-7H,1-4H2 |
| InChIKey | HXGHRBHBAUCWLP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.18 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|