C19H17N7O4 — CID 70601161
ethyl (E)-2-cyano-3-[3-(7-oxotriazolo[4,5-d]pyrimidin-5-yl)-4-propoxyanilino]prop-2-enoate (PubChem CID 70601161) has the molecular formula C19H17N7O4 and a molecular weight of 407.39 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[3-(7-oxotriazolo[4,5-d]pyrimidin-5-yl)-4-propoxyanilino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[3-(7-oxotriazolo[4,5-d]pyrimidin-5-yl)-4-propoxyanilino]prop-2-enoate |
|---|---|
| PubChem CID | 70601161 |
| Molecular Formula | C19H17N7O4 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | ethyl (E)-2-cyano-3-[3-(7-oxotriazolo[4,5-d]pyrimidin-5-yl)-4-propoxyanilino]prop-2-enoate |
| SMILES | CCCOc1ccc(N/C=C(\C#N)C(=O)OCC)cc1C1=NC(=O)C2=NN=NC2=N1 |
| InChI | InChI=1S/C19H17N7O4/c1-3-7-30-14-6-5-12(21-10-11(9-20)19(28)29-4-2)8-13(14)16-22-17-15(18(27)23-16)24-26-25-17/h5-6,8,10,21H,3-4,7H2,1-2H3/b11-10+ |
| InChIKey | SUFYPNXJWUSXCI-ZHACJKMWSA-N |
| XLogP | 2.36 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|