C18H20N2 — CID 70609598
2-naphthalen-2-yl-N,N'-bis(prop-2-enyl)ethanimidamide (PubChem CID 70609598) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-naphthalen-2-yl-N,N'-bis(prop-2-enyl)ethanimidamide.
| Compound Name | 2-naphthalen-2-yl-N,N'-bis(prop-2-enyl)ethanimidamide |
|---|---|
| PubChem CID | 70609598 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2-naphthalen-2-yl-N,N'-bis(prop-2-enyl)ethanimidamide |
| SMILES | C=CC/N=C(/Cc1ccc2ccccc2c1)NCC=C |
| InChI | InChI=1S/C18H20N2/c1-3-11-19-18(20-12-4-2)14-15-9-10-16-7-5-6-8-17(16)13-15/h3-10,13H,1-2,11-12,14H2,(H,19,20) |
| InChIKey | JIIKZLXVLWDNPM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|