C27H27NO3 — CID 70612637
ethyl 3-[4-[acetamido(9H-fluoren-1-yl)methyl]phenyl]propanoate (PubChem CID 70612637) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is ethyl 3-[4-[acetamido(9H-fluoren-1-yl)methyl]phenyl]propanoate.
| Compound Name | ethyl 3-[4-[acetamido(9H-fluoren-1-yl)methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 70612637 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | ethyl 3-[4-[acetamido(9H-fluoren-1-yl)methyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(C(NC(C)=O)c2cccc3c2Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C27H27NO3/c1-3-31-26(30)16-13-19-11-14-20(15-12-19)27(28-18(2)29)24-10-6-9-23-22-8-5-4-7-21(22)17-25(23)24/h4-12,14-15,27H,3,13,16-17H2,1-2H3,(H,28,29) |
| InChIKey | ZVKGWSBPNUZHLQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |