About 1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane
1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane (PubChem CID 70615089) has the molecular formula C14H23IN2O2
and a molecular weight of 378.25 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane.
Molecular Properties
| Compound Name | 1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane |
| PubChem CID | 70615089 |
| Molecular Formula | C14H23IN2O2 |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane |
| SMILES | CCN(CC)C(C)(O)C(=O)c1ccc(N)cc1.CI |
| InChI | InChI=1S/C13H20N2O2.CH3I/c1-4-15(5-2)13(3,17)12(16)10-6-8-11(14)9-7-10;1-2/h6-9,17H,4-5,14H2,1-3H3;1H3 |
| InChIKey | SDNSFVRLWVVYHZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane?
The IUPAC name of 1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane (CID 70615089) is 1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane.
What is the SMILES notation for 1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane?
The canonical SMILES for 1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane is CCN(CC)C(C)(O)C(=O)c1ccc(N)cc1.CI.
What is the InChIKey of 1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane?
The InChIKey is SDNSFVRLWVVYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2.CH3I/c1-4-15(5-2)13(3,17)12(16)10-6-8-11(14)9-7-10;1-2/h6-9,17H,4-5,14H2,1-3H3;1H3.
What are the key properties of 1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane?
1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane has a molecular weight of 378.25 g/mol, XLogP of 2.55, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminophenyl)-2-(diethylamino)-2-hydroxypropan-1-one;iodomethane is sourced from PubChem (CID 70615089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).