C22H24ClFN2O4 — CID 70620740
4-[4-[(4-chlorophenyl)methyl]-4-hydroxypiperidin-1-yl]-1-(4-fluoro-2-nitrophenyl)butan-1-one (PubChem CID 70620740) has the molecular formula C22H24ClFN2O4 and a molecular weight of 434.90 g/mol. Its IUPAC name is 4-[4-[(4-chlorophenyl)methyl]-4-hydroxypiperidin-1-yl]-1-(4-fluoro-2-nitrophenyl)butan-1-one.
| Compound Name | 4-[4-[(4-chlorophenyl)methyl]-4-hydroxypiperidin-1-yl]-1-(4-fluoro-2-nitrophenyl)butan-1-one |
|---|---|
| PubChem CID | 70620740 |
| Molecular Formula | C22H24ClFN2O4 |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 4-[4-[(4-chlorophenyl)methyl]-4-hydroxypiperidin-1-yl]-1-(4-fluoro-2-nitrophenyl)butan-1-one |
| SMILES | O=C(CCCN1CCC(O)(Cc2ccc(Cl)cc2)CC1)c1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24ClFN2O4/c23-17-5-3-16(4-6-17)15-22(28)9-12-25(13-10-22)11-1-2-21(27)19-8-7-18(24)14-20(19)26(29)30/h3-8,14,28H,1-2,9-13,15H2 |
| InChIKey | YUCIDEQSMHWEQM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|