C23H26ClFN2O5 — CID 54292524
4-(4-chlorophenyl)-1-[3-[4-(4-fluoro-2-nitrophenyl)-4-methyl-1,3-dioxetan-2-yl]propyl]piperidin-4-ol (PubChem CID 54292524) has the molecular formula C23H26ClFN2O5 and a molecular weight of 464.92 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-[3-[4-(4-fluoro-2-nitrophenyl)-4-methyl-1,3-dioxetan-2-yl]propyl]piperidin-4-ol.
| Compound Name | 4-(4-chlorophenyl)-1-[3-[4-(4-fluoro-2-nitrophenyl)-4-methyl-1,3-dioxetan-2-yl]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 54292524 |
| Molecular Formula | C23H26ClFN2O5 |
| Molecular Weight | 464.92 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 4-(4-chlorophenyl)-1-[3-[4-(4-fluoro-2-nitrophenyl)-4-methyl-1,3-dioxetan-2-yl]propyl]piperidin-4-ol |
| SMILES | CC1(c2ccc(F)cc2[N+](=O)[O-])OC(CCCN2CCC(O)(c3ccc(Cl)cc3)CC2)O1 |
| InChI | InChI=1S/C23H26ClFN2O5/c1-22(19-9-8-18(25)15-20(19)27(29)30)31-21(32-22)3-2-12-26-13-10-23(28,11-14-26)16-4-6-17(24)7-5-16/h4-9,15,21,28H,2-3,10-14H2,1H3 |
| InChIKey | RYNAZKXBYXLVMC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.92 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|