C24H26F4N2O5 — CID 86735492
1-[3-[2-(4-fluoro-2-nitrophenyl)-1,3-dioxolan-2-yl]propyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol (PubChem CID 86735492) has the molecular formula C24H26F4N2O5 and a molecular weight of 498.47 g/mol. Its IUPAC name is 1-[3-[2-(4-fluoro-2-nitrophenyl)-1,3-dioxolan-2-yl]propyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol.
| Compound Name | 1-[3-[2-(4-fluoro-2-nitrophenyl)-1,3-dioxolan-2-yl]propyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 86735492 |
| Molecular Formula | C24H26F4N2O5 |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 1-[3-[2-(4-fluoro-2-nitrophenyl)-1,3-dioxolan-2-yl]propyl]-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol |
| SMILES | O=[N+]([O-])c1cc(F)ccc1C1(CCCN2CCC(O)(c3cccc(C(F)(F)F)c3)CC2)OCCO1 |
| InChI | InChI=1S/C24H26F4N2O5/c25-19-5-6-20(21(16-19)30(32)33)23(34-13-14-35-23)7-2-10-29-11-8-22(31,9-12-29)17-3-1-4-18(15-17)24(26,27)28/h1,3-6,15-16,31H,2,7-14H2 |
| InChIKey | GYJKLMDJHWFNDK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|