C14H8BrF3NO3- — CID 7062253
5-bromo-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylate (PubChem CID 7062253) has the molecular formula C14H8BrF3NO3- and a molecular weight of 375.12 g/mol. Its IUPAC name is 5-bromo-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylate.
| Compound Name | 5-bromo-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 7062253 |
| Molecular Formula | C14H8BrF3NO3- |
| Molecular Weight | 375.12 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | 5-bromo-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylate |
| SMILES | O=C([O-])c1cc(Br)cn(Cc2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C14H9BrF3NO3/c15-10-5-11(13(21)22)12(20)19(7-10)6-8-2-1-3-9(4-8)14(16,17)18/h1-5,7H,6H2,(H,21,22)/p-1 |
| InChIKey | MWXQWMZIZAEDKS-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 62.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.12 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |