C11H16N4O2S — CID 70624532
3-morpholin-4-yl-2-pyrimidin-2-ylsulfanylpropanamide (PubChem CID 70624532) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 3-morpholin-4-yl-2-pyrimidin-2-ylsulfanylpropanamide.
| Compound Name | 3-morpholin-4-yl-2-pyrimidin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 70624532 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-morpholin-4-yl-2-pyrimidin-2-ylsulfanylpropanamide |
| SMILES | NC(=O)C(CN1CCOCC1)Sc1ncccn1 |
| InChI | InChI=1S/C11H16N4O2S/c12-10(16)9(8-15-4-6-17-7-5-15)18-11-13-2-1-3-14-11/h1-3,9H,4-8H2,(H2,12,16) |
| InChIKey | ALTHPWRGKWQACR-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |