C9H16Cl4N2O3 — CID 70625672
2,2,2-trichloroethyl 4-(2-hydroxyethyl)piperazine-1-carboxylate;hydrochloride (PubChem CID 70625672) has the molecular formula C9H16Cl4N2O3 and a molecular weight of 342.05 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 4-(2-hydroxyethyl)piperazine-1-carboxylate;hydrochloride.
| Compound Name | 2,2,2-trichloroethyl 4-(2-hydroxyethyl)piperazine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 70625672 |
| Molecular Formula | C9H16Cl4N2O3 |
| Molecular Weight | 342.05 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2,2,2-trichloroethyl 4-(2-hydroxyethyl)piperazine-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCC(Cl)(Cl)Cl)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C9H15Cl3N2O3.ClH/c10-9(11,12)7-17-8(16)14-3-1-13(2-4-14)5-6-15;/h15H,1-7H2;1H |
| InChIKey | LLLSEGHUUQMGCX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.05 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|