C19H24N4O6 — CID 70628139
2-aminopyridin-3-ol;diethyl (2Z)-2-[[(3-hydroxy-2-pyridinyl)amino]methylidene]butanedioate (PubChem CID 70628139) has the molecular formula C19H24N4O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-aminopyridin-3-ol;diethyl (2Z)-2-[[(3-hydroxy-2-pyridinyl)amino]methylidene]butanedioate.
| Compound Name | 2-aminopyridin-3-ol;diethyl (2Z)-2-[[(3-hydroxy-2-pyridinyl)amino]methylidene]butanedioate |
|---|---|
| PubChem CID | 70628139 |
| Molecular Formula | C19H24N4O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-aminopyridin-3-ol;diethyl (2Z)-2-[[(3-hydroxy-2-pyridinyl)amino]methylidene]butanedioate |
| SMILES | CCOC(=O)C/C(=C/Nc1ncccc1O)C(=O)OCC.Nc1ncccc1O |
| InChI | InChI=1S/C14H18N2O5.C5H6N2O/c1-3-20-12(18)8-10(14(19)21-4-2)9-16-13-11(17)6-5-7-15-13;6-5-4(8)2-1-3-7-5/h5-7,9,17H,3-4,8H2,1-2H3,(H,15,16);1-3,8H,(H2,6,7)/b10-9-; |
| InChIKey | NPHZZUFNQBGOQA-KVVVOXFISA-N |
| XLogP | 1.97 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|