C31H48O5 — CID 70628196
8-[3-(7-carboxyheptyl)-1-methyl-2-benzofuran-4-yl]octanoic acid;cyclopropane (PubChem CID 70628196) has the molecular formula C31H48O5 and a molecular weight of 500.72 g/mol. Its IUPAC name is 8-[3-(7-carboxyheptyl)-1-methyl-2-benzofuran-4-yl]octanoic acid;cyclopropane.
| Compound Name | 8-[3-(7-carboxyheptyl)-1-methyl-2-benzofuran-4-yl]octanoic acid;cyclopropane |
|---|---|
| PubChem CID | 70628196 |
| Molecular Formula | C31H48O5 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | 8-[3-(7-carboxyheptyl)-1-methyl-2-benzofuran-4-yl]octanoic acid;cyclopropane |
| SMILES | C1CC1.C1CC1.Cc1oc(CCCCCCCC(=O)O)c2c(CCCCCCCC(=O)O)cccc12 |
| InChI | InChI=1S/C25H36O5.2C3H6/c1-19-21-15-12-14-20(13-8-4-2-6-10-17-23(26)27)25(21)22(30-19)16-9-5-3-7-11-18-24(28)29;2*1-2-3-1/h12,14-15H,2-11,13,16-18H2,1H3,(H,26,27)(H,28,29);2*1-3H2 |
| InChIKey | KMXOOEWBEHXWRM-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|