About 2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one
2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one (PubChem CID 70629794) has the molecular formula C21H25NO3
and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one.
Molecular Properties
| Compound Name | 2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one |
| PubChem CID | 70629794 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one |
| SMILES | CC(C)=O.CCOc1ccc(-c2cc3ccccc3[nH]2)cc1OCC |
| InChI | InChI=1S/C18H19NO2.C3H6O/c1-3-20-17-10-9-14(12-18(17)21-4-2)16-11-13-7-5-6-8-15(13)19-16;1-3(2)4/h5-12,19H,3-4H2,1-2H3;1-2H3 |
| InChIKey | JDRWMHZQFLGXQS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one?
The IUPAC name of 2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one (CID 70629794) is 2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one.
What is the SMILES notation for 2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one?
The canonical SMILES for 2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one is CC(C)=O.CCOc1ccc(-c2cc3ccccc3[nH]2)cc1OCC.
What is the InChIKey of 2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one?
The InChIKey is JDRWMHZQFLGXQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO2.C3H6O/c1-3-20-17-10-9-14(12-18(17)21-4-2)16-11-13-7-5-6-8-15(13)19-16;1-3(2)4/h5-12,19H,3-4H2,1-2H3;1-2H3.
What are the key properties of 2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one?
2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one has a molecular weight of 339.44 g/mol, XLogP of 5.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-diethoxyphenyl)-1H-indole;propan-2-one is sourced from PubChem (CID 70629794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).