C16H21NO3 — CID 706298
ethyl (2Z)-2-[(5R)-3,3,7-trimethyl-8-oxo-2-azaspiro[4.5]deca-6,9-dien-1-ylidene]acetate (PubChem CID 706298) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is ethyl (2Z)-2-[(5R)-3,3,7-trimethyl-8-oxo-2-azaspiro[4.5]deca-6,9-dien-1-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(5R)-3,3,7-trimethyl-8-oxo-2-azaspiro[4.5]deca-6,9-dien-1-ylidene]acetate |
|---|---|
| PubChem CID | 706298 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | ethyl (2Z)-2-[(5R)-3,3,7-trimethyl-8-oxo-2-azaspiro[4.5]deca-6,9-dien-1-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\NC(C)(C)C[C@]12C=CC(=O)C(C)=C2 |
| InChI | InChI=1S/C16H21NO3/c1-5-20-14(19)8-13-16(10-15(3,4)17-13)7-6-12(18)11(2)9-16/h6-9,17H,5,10H2,1-4H3/b13-8-/t16-/m1/s1 |
| InChIKey | WEQCTMNMRGRRAW-LPDYGMJQSA-N |
| XLogP | 2.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|