C23H17ClN2O4S — CID 70632278
benzhydryl (6R)-3-chloro-7-(2-cyanoacetyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70632278) has the molecular formula C23H17ClN2O4S and a molecular weight of 452.92 g/mol. Its IUPAC name is benzhydryl (6R)-3-chloro-7-(2-cyanoacetyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-3-chloro-7-(2-cyanoacetyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70632278 |
| Molecular Formula | C23H17ClN2O4S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | benzhydryl (6R)-3-chloro-7-(2-cyanoacetyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | N#CCC(=O)C1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(Cl)CS[C@H]12 |
| InChI | InChI=1S/C23H17ClN2O4S/c24-16-13-31-22-18(17(27)11-12-25)21(28)26(22)19(16)23(29)30-20(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,18,20,22H,11,13H2/t18?,22-/m1/s1 |
| InChIKey | SAKKYYYUWICDKX-LMNIDFBRSA-N |
| XLogP | 3.78 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|