C29H24BrNO6S2 — CID 54229712
2-O-benzhydryl 3-O-(2-bromoethyl) (6S)-8-oxo-7-(2-thiophen-2-ylacetyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,3-dicarboxylate (PubChem CID 54229712) has the molecular formula C29H24BrNO6S2 and a molecular weight of 626.55 g/mol. Its IUPAC name is 2-O-benzhydryl 3-O-(2-bromoethyl) (6S)-8-oxo-7-(2-thiophen-2-ylacetyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,3-dicarboxylate.
| Compound Name | 2-O-benzhydryl 3-O-(2-bromoethyl) (6S)-8-oxo-7-(2-thiophen-2-ylacetyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 54229712 |
| Molecular Formula | C29H24BrNO6S2 |
| Molecular Weight | 626.55 g/mol |
| Exact Mass | 625.02 |
| IUPAC Name | 2-O-benzhydryl 3-O-(2-bromoethyl) (6S)-8-oxo-7-(2-thiophen-2-ylacetyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,3-dicarboxylate |
| SMILES | O=C(OCCBr)C1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(C(=O)Cc3cccs3)[C@@H]2SC1 |
| InChI | InChI=1S/C29H24BrNO6S2/c30-13-14-36-28(34)21-17-39-27-23(22(32)16-20-12-7-15-38-20)26(33)31(27)24(21)29(35)37-25(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-12,15,23,25,27H,13-14,16-17H2/t23?,27-/m0/s1 |
| InChIKey | QIJNRGYCRCPKEE-JVHFYALYSA-N |
| XLogP | 4.92 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|