C26H32N2 — CID 70633407
(7S,8R)-11-(cyclohex-3-en-1-ylmethyl)-1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,4,12(21),14,16-pentaene (PubChem CID 70633407) has the molecular formula C26H32N2 and a molecular weight of 372.56 g/mol. Its IUPAC name is (7S,8R)-11-(cyclohex-3-en-1-ylmethyl)-1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,4,12(21),14,16-pentaene.
| Compound Name | (7S,8R)-11-(cyclohex-3-en-1-ylmethyl)-1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,4,12(21),14,16-pentaene |
|---|---|
| PubChem CID | 70633407 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | (7S,8R)-11-(cyclohex-3-en-1-ylmethyl)-1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,4,12(21),14,16-pentaene |
| SMILES | C1=CCC(CC2CC[C@H]3C4=C2CC=C2C=CCCC2N4C2=CC=NC[C@@H]23)CC1 |
| InChI | InChI=1S/C26H32N2/c1-2-6-18(7-3-1)16-20-11-13-22-23-17-27-15-14-25(23)28-24-9-5-4-8-19(24)10-12-21(20)26(22)28/h1-2,4,8,10,14-15,18,20,22-24H,3,5-7,9,11-13,16-17H2/t18?,20?,22-,23-,24?/m1/s1 |
| InChIKey | ZSYPGSHKDKFZAC-CLDDXQSPSA-N |
| XLogP | 5.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|