C18H19N2+ — CID 3063310
3-aza-12-azoniapentacyclo[10.7.1.02,10.04,9.016,20]icosa-5,7,11,13,15,18-hexaene (PubChem CID 3063310) has the molecular formula C18H19N2+ and a molecular weight of 263.36 g/mol. Its IUPAC name is 3-aza-12-azoniapentacyclo[10.7.1.02,10.04,9.016,20]icosa-5,7,11,13,15,18-hexaene.
| Compound Name | 3-aza-12-azoniapentacyclo[10.7.1.02,10.04,9.016,20]icosa-5,7,11,13,15,18-hexaene |
|---|---|
| PubChem CID | 3063310 |
| Molecular Formula | C18H19N2+ |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-aza-12-azoniapentacyclo[10.7.1.02,10.04,9.016,20]icosa-5,7,11,13,15,18-hexaene |
| SMILES | C1=CC2NC3C(C=[N+]4C=CC=C5CC=CC3C54)C2C=C1 |
| InChI | InChI=1S/C18H19N2/c1-2-9-16-13(7-1)15-11-20-10-4-6-12-5-3-8-14(18(12)20)17(15)19-16/h1-4,6-11,13-19H,5H2/q+1 |
| InChIKey | ZVUCFUCDQBZDOS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|