C15H19ClN2O2S — CID 70636349
2-[2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-yl]propanoic acid (PubChem CID 70636349) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-yl]propanoic acid.
| Compound Name | 2-[2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 70636349 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-yl]propanoic acid |
| SMILES | CCCN1/C(=N/c2ccc(Cl)cc2)SCC1C(C)C(=O)O |
| InChI | InChI=1S/C15H19ClN2O2S/c1-3-8-18-13(10(2)14(19)20)9-21-15(18)17-12-6-4-11(16)5-7-12/h4-7,10,13H,3,8-9H2,1-2H3,(H,19,20)/b17-15- |
| InChIKey | ZROBBEGTMREVCD-ICFOKQHNSA-N |
| XLogP | 3.88 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|