C17H23ClN2O2S — CID 138974626
ethyl (4R,5R)-3-butyl-2-(4-chlorophenyl)imino-4-methyl-1,3-thiazolidine-5-carboxylate (PubChem CID 138974626) has the molecular formula C17H23ClN2O2S and a molecular weight of 354.90 g/mol. Its IUPAC name is ethyl (4R,5R)-3-butyl-2-(4-chlorophenyl)imino-4-methyl-1,3-thiazolidine-5-carboxylate.
| Compound Name | ethyl (4R,5R)-3-butyl-2-(4-chlorophenyl)imino-4-methyl-1,3-thiazolidine-5-carboxylate |
|---|---|
| PubChem CID | 138974626 |
| Molecular Formula | C17H23ClN2O2S |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | ethyl (4R,5R)-3-butyl-2-(4-chlorophenyl)imino-4-methyl-1,3-thiazolidine-5-carboxylate |
| SMILES | CCCCN1/C(=N/c2ccc(Cl)cc2)S[C@@H](C(=O)OCC)[C@H]1C |
| InChI | InChI=1S/C17H23ClN2O2S/c1-4-6-11-20-12(3)15(16(21)22-5-2)23-17(20)19-14-9-7-13(18)8-10-14/h7-10,12,15H,4-6,11H2,1-3H3/b19-17-/t12-,15-/m1/s1 |
| InChIKey | UVIJSUYYJGTVBM-ZGLRAZNNSA-N |
| XLogP | 4.50 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|