C10H9FN2OS — CID 70639287
5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-fluorobenzenethiol (PubChem CID 70639287) has the molecular formula C10H9FN2OS and a molecular weight of 224.26 g/mol. Its IUPAC name is 5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-fluorobenzenethiol.
| Compound Name | 5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-fluorobenzenethiol |
|---|---|
| PubChem CID | 70639287 |
| Molecular Formula | C10H9FN2OS |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-fluorobenzenethiol |
| SMILES | CCc1nc(-c2ccc(F)c(S)c2)no1 |
| InChI | InChI=1S/C10H9FN2OS/c1-2-9-12-10(13-14-9)6-3-4-7(11)8(15)5-6/h3-5,15H,2H2,1H3 |
| InChIKey | XWGXRXQKQRBTBJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|