C11H11FN2O2S — CID 70639306
2-[3-(4-fluoro-3-sulfanylphenyl)-1,2,4-oxadiazol-5-yl]propan-2-ol (PubChem CID 70639306) has the molecular formula C11H11FN2O2S and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[3-(4-fluoro-3-sulfanylphenyl)-1,2,4-oxadiazol-5-yl]propan-2-ol.
| Compound Name | 2-[3-(4-fluoro-3-sulfanylphenyl)-1,2,4-oxadiazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 70639306 |
| Molecular Formula | C11H11FN2O2S |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-[3-(4-fluoro-3-sulfanylphenyl)-1,2,4-oxadiazol-5-yl]propan-2-ol |
| SMILES | CC(C)(O)c1nc(-c2ccc(F)c(S)c2)no1 |
| InChI | InChI=1S/C11H11FN2O2S/c1-11(2,15)10-13-9(14-16-10)6-3-4-7(12)8(17)5-6/h3-5,15,17H,1-2H3 |
| InChIKey | RDLLETPQPQHRLA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|