C29H32N6O12S — CID 70639390
2-[2-(dihydroxyamino)oxyethoxy]ethyl [[6-methoxy-5-(2-methoxyphenoxy)-2-pyridin-4-ylpyrimidin-4-yl]-[(5-methyl-2-pyridinyl)sulfonyl]amino]methyl carbonate (PubChem CID 70639390) has the molecular formula C29H32N6O12S and a molecular weight of 688.67 g/mol. Its IUPAC name is 2-[2-(dihydroxyamino)oxyethoxy]ethyl [[6-methoxy-5-(2-methoxyphenoxy)-2-pyridin-4-ylpyrimidin-4-yl]-[(5-methyl-2-pyridinyl)sulfonyl]amino]methyl carbonate.
| Compound Name | 2-[2-(dihydroxyamino)oxyethoxy]ethyl [[6-methoxy-5-(2-methoxyphenoxy)-2-pyridin-4-ylpyrimidin-4-yl]-[(5-methyl-2-pyridinyl)sulfonyl]amino]methyl carbonate |
|---|---|
| PubChem CID | 70639390 |
| Molecular Formula | C29H32N6O12S |
| Molecular Weight | 688.67 g/mol |
| Exact Mass | 688.18 |
| IUPAC Name | 2-[2-(dihydroxyamino)oxyethoxy]ethyl [[6-methoxy-5-(2-methoxyphenoxy)-2-pyridin-4-ylpyrimidin-4-yl]-[(5-methyl-2-pyridinyl)sulfonyl]amino]methyl carbonate |
| SMILES | COc1ccccc1Oc1c(OC)nc(-c2ccncc2)nc1N(COC(=O)OCCOCCON(O)O)S(=O)(=O)c1ccc(C)cn1 |
| InChI | InChI=1S/C29H32N6O12S/c1-20-8-9-24(31-18-20)48(39,40)34(19-45-29(36)44-16-14-43-15-17-46-35(37)38)27-25(47-23-7-5-4-6-22(23)41-2)28(42-3)33-26(32-27)21-10-12-30-13-11-21/h4-13,18,37-38H,14-17,19H2,1-3H3 |
| InChIKey | LYGYQDWQWDAVGY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 214.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.67 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|