C41H44N5O11SU- — CID 163491263
2-[6-[butoxycarbonyloxymethyl-(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl (3-methylphenyl) carbonate;uranium (PubChem CID 163491263) has the molecular formula C41H44N5O11SU- and a molecular weight of 1052.92 g/mol. Its IUPAC name is 2-[6-[butoxycarbonyloxymethyl-(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl (3-methylphenyl) carbonate;uranium.
| Compound Name | 2-[6-[butoxycarbonyloxymethyl-(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl (3-methylphenyl) carbonate;uranium |
|---|---|
| PubChem CID | 163491263 |
| Molecular Formula | C41H44N5O11SU- |
| Molecular Weight | 1052.92 g/mol |
| Exact Mass | 1052.33 |
| IUPAC Name | 2-[6-[butoxycarbonyloxymethyl-(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl (3-methylphenyl) carbonate;uranium |
| SMILES | [CH2-]CCCOC(=O)OCN(c1nc(-c2ncccn2)nc(OCCOC(=O)Oc2cccc(C)c2)c1Oc1ccccc1OC)S(=O)(=O)c1ccc(C(C)(C)C)cc1.[U] |
| InChI | InChI=1S/C41H44N5O11S.U/c1-7-8-23-53-39(47)55-27-46(58(49,50)31-19-17-29(18-20-31)41(3,4)5)37-34(57-33-16-10-9-15-32(33)51-6)38(45-36(44-37)35-42-21-12-22-43-35)52-24-25-54-40(48)56-30-14-11-13-28(2)26-30;/h9-22,26H,1,7-8,23-25,27H2,2-6H3;/q-1; |
| InChIKey | PLDSZHXZXBRKQX-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 187.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1052.92 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|