C18H23NO2 — CID 70641553
methyl 2-[7-[2-(methylamino)butan-2-yl]naphthalen-2-yl]acetate (PubChem CID 70641553) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is methyl 2-[7-[2-(methylamino)butan-2-yl]naphthalen-2-yl]acetate.
| Compound Name | methyl 2-[7-[2-(methylamino)butan-2-yl]naphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 70641553 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | methyl 2-[7-[2-(methylamino)butan-2-yl]naphthalen-2-yl]acetate |
| SMILES | CCC(C)(NC)c1ccc2ccc(CC(=O)OC)cc2c1 |
| InChI | InChI=1S/C18H23NO2/c1-5-18(2,19-3)16-9-8-14-7-6-13(10-15(14)12-16)11-17(20)21-4/h6-10,12,19H,5,11H2,1-4H3 |
| InChIKey | UEALNRULOHDQFM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |