C9H7ClFN5O — CID 70642450
4-amino-N'-(3-chloro-2-fluorophenyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 70642450) has the molecular formula C9H7ClFN5O and a molecular weight of 255.64 g/mol. Its IUPAC name is 4-amino-N'-(3-chloro-2-fluorophenyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-(3-chloro-2-fluorophenyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 70642450 |
| Molecular Formula | C9H7ClFN5O |
| Molecular Weight | 255.64 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 4-amino-N'-(3-chloro-2-fluorophenyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N\c1cccc(Cl)c1F)c1nonc1N |
| InChI | InChI=1S/C9H7ClFN5O/c10-4-2-1-3-5(6(4)11)14-8(12)7-9(13)16-17-15-7/h1-3H,(H2,12,14)(H2,13,16) |
| InChIKey | CEKYXRMTQZTMMZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.64 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|