C21H25F3N6OS — CID 70643970
[(1R,3S)-3-[[5-(4-ethyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol (PubChem CID 70643970) has the molecular formula C21H25F3N6OS and a molecular weight of 466.53 g/mol. Its IUPAC name is [(1R,3S)-3-[[5-(4-ethyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-3-[[5-(4-ethyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 70643970 |
| Molecular Formula | C21H25F3N6OS |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | [(1R,3S)-3-[[5-(4-ethyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol |
| SMILES | CCc1nccc2sc(-c3c(C)nc(NCC(F)(F)F)nc3N[C@H]3CC[C@@H](CO)C3)nc12 |
| InChI | InChI=1S/C21H25F3N6OS/c1-3-14-17-15(6-7-25-14)32-19(29-17)16-11(2)27-20(26-10-21(22,23)24)30-18(16)28-13-5-4-12(8-13)9-31/h6-7,12-13,31H,3-5,8-10H2,1-2H3,(H2,26,27,28,30)/t12-,13+/m1/s1 |
| InChIKey | LGCINTZPGNACTN-OLZOCXBDSA-N |
| XLogP | 4.57 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |