About 3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one
3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one (PubChem CID 70644597) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one.
Molecular Properties
| Compound Name | 3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one |
| PubChem CID | 70644597 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one |
| SMILES | CCC1(C)C(=O)N(c2ccccc2)CC(C)(C)N1O |
| InChI | InChI=1S/C15H22N2O2/c1-5-15(4)13(18)16(11-14(2,3)17(15)19)12-9-7-6-8-10-12/h6-10,19H,5,11H2,1-4H3 |
| InChIKey | MKGGQTKNRPJZIH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one?
The IUPAC name of 3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one (CID 70644597) is 3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one.
What is the SMILES notation for 3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one?
The canonical SMILES for 3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one is CCC1(C)C(=O)N(c2ccccc2)CC(C)(C)N1O.
What is the InChIKey of 3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one?
The InChIKey is MKGGQTKNRPJZIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-5-15(4)13(18)16(11-14(2,3)17(15)19)12-9-7-6-8-10-12/h6-10,19H,5,11H2,1-4H3.
What are the key properties of 3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one?
3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one has a molecular weight of 262.35 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-hydroxy-3,5,5-trimethyl-1-phenylpiperazin-2-one is sourced from PubChem (CID 70644597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).