C15H25NO — CID 143128028
ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole (PubChem CID 143128028) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole.
| Compound Name | ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole |
|---|---|
| PubChem CID | 143128028 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole |
| SMILES | CC.CCC1(C)c2ccccc2C(C)(C)N1O |
| InChI | InChI=1S/C13H19NO.C2H6/c1-5-13(4)11-9-7-6-8-10(11)12(2,3)14(13)15;1-2/h6-9,15H,5H2,1-4H3;1-2H3 |
| InChIKey | GWGJLLLBLNOPFZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |