About ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole
ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole (PubChem CID 143128028) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole.
Molecular Properties
| Compound Name | ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole |
| PubChem CID | 143128028 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole |
| SMILES | CC.CCC1(C)c2ccccc2C(C)(C)N1O |
| InChI | InChI=1S/C13H19NO.C2H6/c1-5-13(4)11-9-7-6-8-10(11)12(2,3)14(13)15;1-2/h6-9,15H,5H2,1-4H3;1-2H3 |
| InChIKey | GWGJLLLBLNOPFZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole?
The IUPAC name of ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole (CID 143128028) is ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole.
What is the SMILES notation for ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole?
The canonical SMILES for ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole is CC.CCC1(C)c2ccccc2C(C)(C)N1O.
What is the InChIKey of ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole?
The InChIKey is GWGJLLLBLNOPFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO.C2H6/c1-5-13(4)11-9-7-6-8-10(11)12(2,3)14(13)15;1-2/h6-9,15H,5H2,1-4H3;1-2H3.
What are the key properties of ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole?
ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole has a molecular weight of 235.37 g/mol, XLogP of 4.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-2-hydroxy-1,3,3-trimethylisoindole is sourced from PubChem (CID 143128028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).