C23H32FN3 — CID 70645916
N-[(3-tert-butyl-5-piperazin-1-ylphenyl)methyl]-2-(4-fluorophenyl)ethanamine (PubChem CID 70645916) has the molecular formula C23H32FN3 and a molecular weight of 369.53 g/mol. Its IUPAC name is N-[(3-tert-butyl-5-piperazin-1-ylphenyl)methyl]-2-(4-fluorophenyl)ethanamine.
| Compound Name | N-[(3-tert-butyl-5-piperazin-1-ylphenyl)methyl]-2-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 70645916 |
| Molecular Formula | C23H32FN3 |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | N-[(3-tert-butyl-5-piperazin-1-ylphenyl)methyl]-2-(4-fluorophenyl)ethanamine |
| SMILES | CC(C)(C)c1cc(CNCCc2ccc(F)cc2)cc(N2CCNCC2)c1 |
| InChI | InChI=1S/C23H32FN3/c1-23(2,3)20-14-19(15-22(16-20)27-12-10-25-11-13-27)17-26-9-8-18-4-6-21(24)7-5-18/h4-7,14-16,25-26H,8-13,17H2,1-3H3 |
| InChIKey | QSCRSUAXBDOJLV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|