C20H21N3 — CID 70651051
12-tert-butyl-8,9-dimethyl-10,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,11(16),12,14-octaene (PubChem CID 70651051) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is 12-tert-butyl-8,9-dimethyl-10,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,11(16),12,14-octaene.
| Compound Name | 12-tert-butyl-8,9-dimethyl-10,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 70651051 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 12-tert-butyl-8,9-dimethyl-10,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,11(16),12,14-octaene |
| SMILES | Cc1c(C)n2c(nc3ccnc(C(C)(C)C)c32)c2ccccc12 |
| InChI | InChI=1S/C20H21N3/c1-12-13(2)23-17-16(10-11-21-18(17)20(3,4)5)22-19(23)15-9-7-6-8-14(12)15/h6-11H,1-5H3 |
| InChIKey | NCGYCOQNPNWWQD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |