C11H6N3O6- — CID 7065148
2-nitro-6-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenolate (PubChem CID 7065148) has the molecular formula C11H6N3O6- and a molecular weight of 276.18 g/mol. Its IUPAC name is 2-nitro-6-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenolate.
| Compound Name | 2-nitro-6-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenolate |
|---|---|
| PubChem CID | 7065148 |
| Molecular Formula | C11H6N3O6- |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-nitro-6-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenolate |
| SMILES | O=C1NC(=O)C(=Cc2cccc([N+](=O)[O-])c2[O-])C(=O)N1 |
| InChI | InChI=1S/C11H7N3O6/c15-8-5(2-1-3-7(8)14(19)20)4-6-9(16)12-11(18)13-10(6)17/h1-4,15H,(H2,12,13,16,17,18)/p-1 |
| InChIKey | AQJBPFFHRKLHMC-UHFFFAOYSA-M |
| XLogP | -0.58 |
| TPSA | 141.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|