C24H19N7O5 — CID 132993119
5-[[1-[[1-[(2-methyl-3-nitrophenyl)methyl]triazol-4-yl]methyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 132993119) has the molecular formula C24H19N7O5 and a molecular weight of 485.46 g/mol. Its IUPAC name is 5-[[1-[[1-[(2-methyl-3-nitrophenyl)methyl]triazol-4-yl]methyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[1-[[1-[(2-methyl-3-nitrophenyl)methyl]triazol-4-yl]methyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 132993119 |
| Molecular Formula | C24H19N7O5 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 5-[[1-[[1-[(2-methyl-3-nitrophenyl)methyl]triazol-4-yl]methyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1c(Cn2cc(Cn3cc(C=C4C(=O)NC(=O)NC4=O)c4ccccc43)nn2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H19N7O5/c1-14-15(5-4-8-20(14)31(35)36)11-30-13-17(27-28-30)12-29-10-16(18-6-2-3-7-21(18)29)9-19-22(32)25-24(34)26-23(19)33/h2-10,13H,11-12H2,1H3,(H2,25,26,32,33,34) |
| InChIKey | APZPEPYVRCVSFX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 154.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|