C13H21N5 — CID 70652831
1-(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-1,2-dimethylhydrazine (PubChem CID 70652831) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is 1-(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-1,2-dimethylhydrazine.
| Compound Name | 1-(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-1,2-dimethylhydrazine |
|---|---|
| PubChem CID | 70652831 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 1-(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-1,2-dimethylhydrazine |
| SMILES | CNN(C)c1cc(C(C)C)c2c(C)nn(C)c2n1 |
| InChI | InChI=1S/C13H21N5/c1-8(2)10-7-11(17(5)14-4)15-13-12(10)9(3)16-18(13)6/h7-8,14H,1-6H3 |
| InChIKey | VRBBSAJPQNUPPX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|