C23H36ClN3O — CID 70653329
3-[1-(3-chloro-2-methylphenyl)ethyl]-1-(cyclohexylmethyl)-1-(1-methylpiperidin-4-yl)urea (PubChem CID 70653329) has the molecular formula C23H36ClN3O and a molecular weight of 406.01 g/mol. Its IUPAC name is 3-[1-(3-chloro-2-methylphenyl)ethyl]-1-(cyclohexylmethyl)-1-(1-methylpiperidin-4-yl)urea.
| Compound Name | 3-[1-(3-chloro-2-methylphenyl)ethyl]-1-(cyclohexylmethyl)-1-(1-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 70653329 |
| Molecular Formula | C23H36ClN3O |
| Molecular Weight | 406.01 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 3-[1-(3-chloro-2-methylphenyl)ethyl]-1-(cyclohexylmethyl)-1-(1-methylpiperidin-4-yl)urea |
| SMILES | Cc1c(Cl)cccc1C(C)NC(=O)N(CC1CCCCC1)C1CCN(C)CC1 |
| InChI | InChI=1S/C23H36ClN3O/c1-17-21(10-7-11-22(17)24)18(2)25-23(28)27(16-19-8-5-4-6-9-19)20-12-14-26(3)15-13-20/h7,10-11,18-20H,4-6,8-9,12-16H2,1-3H3,(H,25,28) |
| InChIKey | SPOXTAQHMTYZOI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.01 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |