C18H28ClN3O — CID 70653331
3-[(1R)-1-(3-chloro-2-methylphenyl)ethyl]-1-ethyl-1-(1-methylpiperidin-4-yl)urea (PubChem CID 70653331) has the molecular formula C18H28ClN3O and a molecular weight of 337.90 g/mol. Its IUPAC name is 3-[(1R)-1-(3-chloro-2-methylphenyl)ethyl]-1-ethyl-1-(1-methylpiperidin-4-yl)urea.
| Compound Name | 3-[(1R)-1-(3-chloro-2-methylphenyl)ethyl]-1-ethyl-1-(1-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 70653331 |
| Molecular Formula | C18H28ClN3O |
| Molecular Weight | 337.90 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 3-[(1R)-1-(3-chloro-2-methylphenyl)ethyl]-1-ethyl-1-(1-methylpiperidin-4-yl)urea |
| SMILES | CCN(C(=O)N[C@H](C)c1cccc(Cl)c1C)C1CCN(C)CC1 |
| InChI | InChI=1S/C18H28ClN3O/c1-5-22(15-9-11-21(4)12-10-15)18(23)20-14(3)16-7-6-8-17(19)13(16)2/h6-8,14-15H,5,9-12H2,1-4H3,(H,20,23)/t14-/m1/s1 |
| InChIKey | JNVRYKDOUWHRNC-CQSZACIVSA-N |
| XLogP | 3.84 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.90 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |