C19H30ClN3O — CID 70653454
3-[1-(3-chloro-2-methylphenyl)propyl]-1-ethyl-1-(1-methylpiperidin-4-yl)urea (PubChem CID 70653454) has the molecular formula C19H30ClN3O and a molecular weight of 351.92 g/mol. Its IUPAC name is 3-[1-(3-chloro-2-methylphenyl)propyl]-1-ethyl-1-(1-methylpiperidin-4-yl)urea.
| Compound Name | 3-[1-(3-chloro-2-methylphenyl)propyl]-1-ethyl-1-(1-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 70653454 |
| Molecular Formula | C19H30ClN3O |
| Molecular Weight | 351.92 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 3-[1-(3-chloro-2-methylphenyl)propyl]-1-ethyl-1-(1-methylpiperidin-4-yl)urea |
| SMILES | CCC(NC(=O)N(CC)C1CCN(C)CC1)c1cccc(Cl)c1C |
| InChI | InChI=1S/C19H30ClN3O/c1-5-18(16-8-7-9-17(20)14(16)3)21-19(24)23(6-2)15-10-12-22(4)13-11-15/h7-9,15,18H,5-6,10-13H2,1-4H3,(H,21,24) |
| InChIKey | LVJPWTAADGRIAC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.92 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |