C17H8N6 — CID 70653417
2-(1,10-phenanthrolin-2-yl)-1H-imidazole-4,5-dicarbonitrile (PubChem CID 70653417) has the molecular formula C17H8N6 and a molecular weight of 296.29 g/mol. Its IUPAC name is 2-(1,10-phenanthrolin-2-yl)-1H-imidazole-4,5-dicarbonitrile.
| Compound Name | 2-(1,10-phenanthrolin-2-yl)-1H-imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 70653417 |
| Molecular Formula | C17H8N6 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-(1,10-phenanthrolin-2-yl)-1H-imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1nc(-c2ccc3ccc4cccnc4c3n2)[nH]c1C#N |
| InChI | InChI=1S/C17H8N6/c18-8-13-14(9-19)23-17(22-13)12-6-5-11-4-3-10-2-1-7-20-15(10)16(11)21-12/h1-7H,(H,22,23) |
| InChIKey | FBKQYBVTCDZVOS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|