C25H34F3N3O5S3 — CID 70655132
(2S)-2-[4-[(2S)-2-[[(3S)-3-cyclopropyl-1,1-dihydroxy-1,4-thiazinan-4-yl]methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 70655132) has the molecular formula C25H34F3N3O5S3 and a molecular weight of 609.76 g/mol. Its IUPAC name is (2S)-2-[4-[(2S)-2-[[(3S)-3-cyclopropyl-1,1-dihydroxy-1,4-thiazinan-4-yl]methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-2-[4-[(2S)-2-[[(3S)-3-cyclopropyl-1,1-dihydroxy-1,4-thiazinan-4-yl]methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 70655132 |
| Molecular Formula | C25H34F3N3O5S3 |
| Molecular Weight | 609.76 g/mol |
| Exact Mass | 609.16 |
| IUPAC Name | (2S)-2-[4-[(2S)-2-[[(3S)-3-cyclopropyl-1,1-dihydroxy-1,4-thiazinan-4-yl]methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | C[C@](O)(c1ccc(N2CCN(S(=O)(=O)c3cccs3)C[C@@H]2CN2CCS(O)(O)C[C@@H]2C2CC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H34F3N3O5S3/c1-24(32,25(26,27)28)19-6-8-20(9-7-19)31-11-10-30(39(35,36)23-3-2-13-37-23)16-21(31)15-29-12-14-38(33,34)17-22(29)18-4-5-18/h2-3,6-9,13,18,21-22,32-34H,4-5,10-12,14-17H2,1H3/t21-,22+,24-/m0/s1 |
| InChIKey | LURQTJJAMZTNPF-ZDXQCDESSA-N |
| XLogP | 4.24 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.76 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|