C17H16F3NO4 — CID 70655294
methyl 6-[4-(2-ethoxyethoxy)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxylate (PubChem CID 70655294) has the molecular formula C17H16F3NO4 and a molecular weight of 355.31 g/mol. Its IUPAC name is methyl 6-[4-(2-ethoxyethoxy)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxylate.
| Compound Name | methyl 6-[4-(2-ethoxyethoxy)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxylate |
|---|---|
| PubChem CID | 70655294 |
| Molecular Formula | C17H16F3NO4 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | methyl 6-[4-(2-ethoxyethoxy)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxylate |
| SMILES | CCOCCOc1cc(F)c(-c2nc(C(=O)OC)ccc2F)c(F)c1 |
| InChI | InChI=1S/C17H16F3NO4/c1-3-24-6-7-25-10-8-12(19)15(13(20)9-10)16-11(18)4-5-14(21-16)17(22)23-2/h4-5,8-9H,3,6-7H2,1-2H3 |
| InChIKey | ADKKCYGNXPNCAG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|