C13H7F3NO2- — CID 86670160
6-(2,6-difluoro-4-methylphenyl)-5-fluoropyridine-2-carboxylate (PubChem CID 86670160) has the molecular formula C13H7F3NO2- and a molecular weight of 266.20 g/mol. Its IUPAC name is 6-(2,6-difluoro-4-methylphenyl)-5-fluoropyridine-2-carboxylate.
| Compound Name | 6-(2,6-difluoro-4-methylphenyl)-5-fluoropyridine-2-carboxylate |
|---|---|
| PubChem CID | 86670160 |
| Molecular Formula | C13H7F3NO2- |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 6-(2,6-difluoro-4-methylphenyl)-5-fluoropyridine-2-carboxylate |
| SMILES | Cc1cc(F)c(-c2nc(C(=O)[O-])ccc2F)c(F)c1 |
| InChI | InChI=1S/C13H8F3NO2/c1-6-4-8(15)11(9(16)5-6)12-7(14)2-3-10(17-12)13(18)19/h2-5H,1H3,(H,18,19)/p-1 |
| InChIKey | KJAHGBLVAVLPQF-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |