C26H28N4O2 — CID 70656661
1-methyl-4-[3-[(3-pyridin-3-yl-1-pyridin-4-ylpropyl)amino]propoxy]quinolin-2-one (PubChem CID 70656661) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-methyl-4-[3-[(3-pyridin-3-yl-1-pyridin-4-ylpropyl)amino]propoxy]quinolin-2-one.
| Compound Name | 1-methyl-4-[3-[(3-pyridin-3-yl-1-pyridin-4-ylpropyl)amino]propoxy]quinolin-2-one |
|---|---|
| PubChem CID | 70656661 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-methyl-4-[3-[(3-pyridin-3-yl-1-pyridin-4-ylpropyl)amino]propoxy]quinolin-2-one |
| SMILES | Cn1c(=O)cc(OCCCNC(CCc2cccnc2)c2ccncc2)c2ccccc21 |
| InChI | InChI=1S/C26H28N4O2/c1-30-24-8-3-2-7-22(24)25(18-26(30)31)32-17-5-14-29-23(21-11-15-27-16-12-21)10-9-20-6-4-13-28-19-20/h2-4,6-8,11-13,15-16,18-19,23,29H,5,9-10,14,17H2,1H3 |
| InChIKey | KAAABGACJBWUFD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|