C34H39N5O4 — CID 68673573
1-ethyl-3,3,5-trimethyl-7-[3-[[3-(2-oxoquinolin-1-yl)-1-pyridin-3-ylpropyl]amino]propoxy]-1,5-benzodiazepine-2,4-dione (PubChem CID 68673573) has the molecular formula C34H39N5O4 and a molecular weight of 581.72 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[3-[[3-(2-oxoquinolin-1-yl)-1-pyridin-3-ylpropyl]amino]propoxy]-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[3-[[3-(2-oxoquinolin-1-yl)-1-pyridin-3-ylpropyl]amino]propoxy]-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 68673573 |
| Molecular Formula | C34H39N5O4 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[3-[[3-(2-oxoquinolin-1-yl)-1-pyridin-3-ylpropyl]amino]propoxy]-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCNC(CCn3c(=O)ccc4ccccc43)c3cccnc3)ccc21 |
| InChI | InChI=1S/C34H39N5O4/c1-5-38-29-15-14-26(22-30(29)37(4)32(41)34(2,3)33(38)42)43-21-9-19-36-27(25-11-8-18-35-23-25)17-20-39-28-12-7-6-10-24(28)13-16-31(39)40/h6-8,10-16,18,22-23,27,36H,5,9,17,19-21H2,1-4H3 |
| InChIKey | YVIXERIOXIGXGT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|