C19H34N4 — CID 70658066
N'-[[4-[[[1-(aminomethyl)cyclohexyl]methylamino]methyl]phenyl]methyl]propane-1,3-diamine (PubChem CID 70658066) has the molecular formula C19H34N4 and a molecular weight of 318.51 g/mol. Its IUPAC name is N'-[[4-[[[1-(aminomethyl)cyclohexyl]methylamino]methyl]phenyl]methyl]propane-1,3-diamine.
| Compound Name | N'-[[4-[[[1-(aminomethyl)cyclohexyl]methylamino]methyl]phenyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 70658066 |
| Molecular Formula | C19H34N4 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | N'-[[4-[[[1-(aminomethyl)cyclohexyl]methylamino]methyl]phenyl]methyl]propane-1,3-diamine |
| SMILES | NCCCNCc1ccc(CNCC2(CN)CCCCC2)cc1 |
| InChI | InChI=1S/C19H34N4/c20-11-4-12-22-13-17-5-7-18(8-6-17)14-23-16-19(15-21)9-2-1-3-10-19/h5-8,22-23H,1-4,9-16,20-21H2 |
| InChIKey | SNKMPGJKJBULLK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|