C16H23NO3 — CID 7065948
[(2R,4R,5R)-1,2,5-trimethylpiperidin-4-yl] 2-methoxybenzoate (PubChem CID 7065948) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is [(2R,4R,5R)-1,2,5-trimethylpiperidin-4-yl] 2-methoxybenzoate.
| Compound Name | [(2R,4R,5R)-1,2,5-trimethylpiperidin-4-yl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 7065948 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | [(2R,4R,5R)-1,2,5-trimethylpiperidin-4-yl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)O[C@@H]1C[C@@H](C)N(C)C[C@H]1C |
| InChI | InChI=1S/C16H23NO3/c1-11-10-17(3)12(2)9-15(11)20-16(18)13-7-5-6-8-14(13)19-4/h5-8,11-12,15H,9-10H2,1-4H3/t11-,12-,15-/m1/s1 |
| InChIKey | KTZCSPSWFXRDPE-LALPHHSUSA-N |
| XLogP | 2.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |