C28H30O6 — CID 174182076
[5-(2-methoxybenzoyl)oxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 2-methoxybenzoate (PubChem CID 174182076) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is [5-(2-methoxybenzoyl)oxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 2-methoxybenzoate.
| Compound Name | [5-(2-methoxybenzoyl)oxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 174182076 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | [5-(2-methoxybenzoyl)oxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OC1C2CC(C1OC(=O)c1ccccc1OC)C1C3CCC(C3)C21 |
| InChI | InChI=1S/C28H30O6/c1-31-21-9-5-3-7-17(21)27(29)33-25-19-14-20(24-16-12-11-15(13-16)23(19)24)26(25)34-28(30)18-8-4-6-10-22(18)32-2/h3-10,15-16,19-20,23-26H,11-14H2,1-2H3 |
| InChIKey | KVAMUYUABACJLI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|