C16H19NO3 — CID 70660368
(11S,12R)-13-methyl-7-(methylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),9-tetraene-2,11-diol (PubChem CID 70660368) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (11S,12R)-13-methyl-7-(methylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),9-tetraene-2,11-diol.
| Compound Name | (11S,12R)-13-methyl-7-(methylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),9-tetraene-2,11-diol |
|---|---|
| PubChem CID | 70660368 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (11S,12R)-13-methyl-7-(methylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),9-tetraene-2,11-diol |
| SMILES | CNC1Cc2ccc(O)c3c2C2(C)C1C=C[C@H](O)[C@@H]2O3 |
| InChI | InChI=1S/C16H19NO3/c1-16-9-4-6-12(19)15(16)20-14-11(18)5-3-8(13(14)16)7-10(9)17-2/h3-6,9-10,12,15,17-19H,7H2,1-2H3/t9?,10?,12-,15-,16?/m0/s1 |
| InChIKey | QKWSTABMYGNSIP-WHEJCZINSA-N |
| XLogP | 1.10 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|